CAS 1568065-39-3 is the registry number for (1R)-1-(2,4,6-Trifluorophenyl)ethan-1-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1R)-1-(2,4,6-trifluorophenyl)ethanol (CAS 1568065-39-3) is a chemical compound with the molecular formula C8H7F3O and a molecular weight of 176.14 g/mol. IUPAC name: (1R)-1-(2,4,6-trifluorophenyl)ethanol. InChIKey: DMGIAUMXLVQIHA-SCSAIBSYSA-N.
| Molecular formula | C8H7F3O |
|---|---|
| Molecular weight | 176.14 g/mol |
| IUPAC name | (1R)-1-(2,4,6-trifluorophenyl)ethanol |
| InChIKey | DMGIAUMXLVQIHA-SCSAIBSYSA-N |
| SMILES | C[C@H](C1=C(C=C(C=C1F)F)F)O |
Computed by PubChem (NCBI)