CAS 1568070-60-9 is the registry number for (S)-8-Bromochroman-4-ol, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(4S)-8-bromo-3,4-dihydro-2H-chromen-4-ol (CAS 1568070-60-9) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: (4S)-8-bromo-3,4-dihydro-2H-chromen-4-ol. InChIKey: VAORXMXHTGIUFI-QMMMGPOBSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | (4S)-8-bromo-3,4-dihydro-2H-chromen-4-ol |
| InChIKey | VAORXMXHTGIUFI-QMMMGPOBSA-N |
| SMILES | C1COC2=C([C@H]1O)C=CC=C2Br |
Computed by PubChem (NCBI)