CAS 1568087-47-7 is the registry number for (R)-7-(tert-Butyl)-1,2,3,4-tetrahydronaphthalen-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-7-tert-butyl-1,2,3,4-tetrahydronaphthalen-1-ol (CAS 1568087-47-7) is a chemical compound with the molecular formula C14H20O and a molecular weight of 204.31 g/mol. IUPAC name: (1R)-7-tert-butyl-1,2,3,4-tetrahydronaphthalen-1-ol. InChIKey: KJWNQLOVTDLMGK-CYBMUJFWSA-N.
| Molecular formula | C14H20O |
|---|---|
| Molecular weight | 204.31 g/mol |
| IUPAC name | (1R)-7-tert-butyl-1,2,3,4-tetrahydronaphthalen-1-ol |
| InChIKey | KJWNQLOVTDLMGK-CYBMUJFWSA-N |
| SMILES | CC(C)(C)C1=CC2=C(CCC[C@H]2O)C=C1 |
Computed by PubChem (NCBI)