CAS 1568168-36-4 is the registry number for (R)-6-Bromo-1,2,3,4-tetrahydronaphthalen-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(4R)-7-bromo-3,4-dihydro-2H-chromen-4-ol (CAS 1568168-36-4) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: (4R)-7-bromo-3,4-dihydro-2H-chromen-4-ol. InChIKey: CORGRUDPFWKFGE-MRVPVSSYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | (4R)-7-bromo-3,4-dihydro-2H-chromen-4-ol |
| InChIKey | CORGRUDPFWKFGE-MRVPVSSYSA-N |
| SMILES | C1COC2=C([C@@H]1O)C=CC(=C2)Br |
Computed by PubChem (NCBI)