CAS 156912-01-5 is the registry number for 4-Chloro-1h-pyrazolo[4,3-c]quinolin-3-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-1H-pyrazolo[4,5-c]quinolin-3-amine (CAS 156912-01-5) is a chemical compound with the molecular formula C10H7ClN4 and a molecular weight of 218.64 g/mol. IUPAC name: 4-chloro-1H-pyrazolo[4,5-c]quinolin-3-amine. InChIKey: AMVJJCAHVNYNRT-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN4 |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | 4-chloro-1H-pyrazolo[4,5-c]quinolin-3-amine |
| InChIKey | AMVJJCAHVNYNRT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C(=NN3)N)C(=N2)Cl |
Computed by PubChem (NCBI)