CAS 2451658-74-3 is the registry number for Letrozole Impurity 37. Offered by: Chemat Brand. Available pack sizes: on request.
4-[chloro(1,2,4-triazol-1-yl)methyl]benzonitrile (CAS 2451658-74-3) is a chemical compound with the molecular formula C10H7ClN4 and a molecular weight of 218.64 g/mol. IUPAC name: 4-[chloro(1,2,4-triazol-1-yl)methyl]benzonitrile. InChIKey: VEORKFAKEMBZJG-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN4 |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | 4-[chloro(1,2,4-triazol-1-yl)methyl]benzonitrile |
| InChIKey | VEORKFAKEMBZJG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C(N2C=NC=N2)Cl |
Computed by PubChem (NCBI)