CAS 2762674-63-3 is the registry number for 2-Chloro-4-methylpyrido[1,2-e]purine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-4-methylpurino[9,8-a]pyridine (CAS 2762674-63-3) is a chemical compound with the molecular formula C10H7ClN4 and a molecular weight of 218.64 g/mol. IUPAC name: 2-chloro-4-methylpurino[9,8-a]pyridine. InChIKey: SNCXQMKUCXZGMK-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN4 |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | 2-chloro-4-methylpurino[9,8-a]pyridine |
| InChIKey | SNCXQMKUCXZGMK-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NC(=N1)Cl)N3C=CC=CC3=N2 |
Computed by PubChem (NCBI)