CAS 1570-09-8 appears in our catalog under these names: 5,7–Dihydroxy–3,4',8–trimethoxyflavone, 5,7-Dihydroxy-3,4',8-trimethoxyflavone, 98.0%, 5,7-Dihydroxy-3,4',8-trimethoxyflavone, ≥98%, ≥98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 1 mg, 5mg.
5,7-dihydroxy-3,8-dimethoxy-2-(4-methoxyphenyl)chromen-4-one (CAS 1570-09-8) is a chemical compound with the molecular formula C18H16O7 and a molecular weight of 344.3 g/mol. IUPAC name: 5,7-dihydroxy-3,8-dimethoxy-2-(4-methoxyphenyl)chromen-4-one. InChIKey: RXQVMRRNRHSOTC-UHFFFAOYSA-N.
| Molecular formula | C18H16O7 |
|---|---|
| Molecular weight | 344.3 g/mol |
| IUPAC name | 5,7-dihydroxy-3,8-dimethoxy-2-(4-methoxyphenyl)chromen-4-one |
| InChIKey | RXQVMRRNRHSOTC-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C(=O)C3=C(O2)C(=C(C=C3O)O)OC)OC |
Computed by PubChem (NCBI)