CAS 157018-14-9 is the registry number for (R)-1,4(1,4)-Dibenzenacyclohexaphan-12-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaen-5-ol (CAS 157018-14-9) is a chemical compound with the molecular formula C16H16O and a molecular weight of 224.30 g/mol. IUPAC name: tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaen-5-ol. InChIKey: OGJZTZSDXOCMNS-UHFFFAOYSA-N.
| Molecular formula | C16H16O |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaen-5-ol |
| InChIKey | OGJZTZSDXOCMNS-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=C(CCC3=CC=C1C=C3)C=C2)O |
Computed by PubChem (NCBI)