CAS 677022-27-4 appears in our catalog under these names: 1-(3',5'-Dimethyl-[1,1'-biphenyl]-4-yl)ethanone, 95%, 1-(3',5'-Dimethyl-[1,1'-biphenyl]-4-yl)ethanone, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg.
1-[4-(3,5-dimethylphenyl)phenyl]ethanone (CAS 677022-27-4) is a chemical compound with the molecular formula C16H16O and a molecular weight of 224.30 g/mol. IUPAC name: 1-[4-(3,5-dimethylphenyl)phenyl]ethanone. InChIKey: UBMOPBKMERPGRG-UHFFFAOYSA-N.
| Molecular formula | C16H16O |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | 1-[4-(3,5-dimethylphenyl)phenyl]ethanone |
| InChIKey | UBMOPBKMERPGRG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=CC=C(C=C2)C(=O)C)C |
Computed by PubChem (NCBI)