Products 52890-52-5
CAS 52890-52-5 appears in our catalog under these names: 2,4,5-Trimethylbenzophenone, 95%, 2,4,5–Trimethylbenzophenone, 2,4,5-Trimethylbenzophenone, >95.0%(GC), Phenyl(2,4,5-trimethylphenyl)methanone 95%, Phenyl(2,4,5-trimethylphenyl)methanone, 95%, 95%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
Phenyl-(2,4,5-trimethylphenyl)methanone (CAS 52890-52-5) is a chemical compound with the molecular formula C16H16O and a molecular weight of 224.30 g/mol. IUPAC name: phenyl-(2,4,5-trimethylphenyl)methanone. InChIKey: FTPZYWUJDVZEIE-UHFFFAOYSA-N.
| Molecular formula | C16H16O |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | phenyl-(2,4,5-trimethylphenyl)methanone |
| InChIKey | FTPZYWUJDVZEIE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)C(=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)