CAS 157056-58-1 appears in our catalog under these names: (2S,6S)-2,6-Diallyl-4-methyl-1,2,3,6-tetrahydropyridine, 95%, rel-(2S,6S)-2,6-Diallyl-4-methyl-1,2,3,6-tetrahydropyridine, 98+%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 5g, on request.
(2S,6S)-4-methyl-2,6-bis(prop-2-enyl)-1,2,3,6-tetrahydropyridine (CAS 157056-58-1) is a chemical compound with the molecular formula C12H19N and a molecular weight of 177.29 g/mol. IUPAC name: (2S,6S)-4-methyl-2,6-bis(prop-2-enyl)-1,2,3,6-tetrahydropyridine. InChIKey: BDKVHGIIDKMPBK-RYUDHWBXSA-N.
| Molecular formula | C12H19N |
|---|---|
| Molecular weight | 177.29 g/mol |
| IUPAC name | (2S,6S)-4-methyl-2,6-bis(prop-2-enyl)-1,2,3,6-tetrahydropyridine |
| InChIKey | BDKVHGIIDKMPBK-RYUDHWBXSA-N |
| SMILES | CC1=C[C@@H](N[C@H](C1)CC=C)CC=C |
Computed by PubChem (NCBI)