Products 1571-65-9

CAS 1571-65-9 is the registry number for 3-Amino-4-hydroxybenzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 25g, 10g, 50g, 100g.

Structural formula: {0} (CAS {1})

3-amino-4-hydroxybenzoic acid;hydrochloride (CAS 1571-65-9) is a chemical compound with the molecular formula C7H8ClNO3 and a molecular weight of 189.59 g/mol. IUPAC name: 3-amino-4-hydroxybenzoic acid;hydrochloride. InChIKey: WHQWETPIAIQHFZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8ClNO3
Molecular weight189.59 g/mol
IUPAC name3-amino-4-hydroxybenzoic acid;hydrochloride
InChIKeyWHQWETPIAIQHFZ-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)O)N)O.Cl

Computed by PubChem (NCBI)