CAS 1571-65-9 is the registry number for 3-Amino-4-hydroxybenzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 25g, 10g, 50g, 100g.
3-amino-4-hydroxybenzoic acid;hydrochloride (CAS 1571-65-9) is a chemical compound with the molecular formula C7H8ClNO3 and a molecular weight of 189.59 g/mol. IUPAC name: 3-amino-4-hydroxybenzoic acid;hydrochloride. InChIKey: WHQWETPIAIQHFZ-UHFFFAOYSA-N.
| Molecular formula | C7H8ClNO3 |
|---|---|
| Molecular weight | 189.59 g/mol |
| IUPAC name | 3-amino-4-hydroxybenzoic acid;hydrochloride |
| InChIKey | WHQWETPIAIQHFZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)N)O.Cl |
Computed by PubChem (NCBI)