Products 1571067-21-4

CAS 1571067-21-4 is the registry number for Cis-3-hydroxy-1-(4-methoxyphenyl)cyclobutane-1-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-hydroxy-1-(4-methoxyphenyl)cyclobutane-1-carboxylic acid (CAS 1571067-21-4) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 3-hydroxy-1-(4-methoxyphenyl)cyclobutane-1-carboxylic acid. InChIKey: LFTFNYUHJMESTD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O4
Molecular weight222.24 g/mol
IUPAC name3-hydroxy-1-(4-methoxyphenyl)cyclobutane-1-carboxylic acid
InChIKeyLFTFNYUHJMESTD-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)C2(CC(C2)O)C(=O)O

Computed by PubChem (NCBI)