CAS 1571067-21-4 is the registry number for Cis-3-hydroxy-1-(4-methoxyphenyl)cyclobutane-1-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
3-hydroxy-1-(4-methoxyphenyl)cyclobutane-1-carboxylic acid (CAS 1571067-21-4) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 3-hydroxy-1-(4-methoxyphenyl)cyclobutane-1-carboxylic acid. InChIKey: LFTFNYUHJMESTD-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 3-hydroxy-1-(4-methoxyphenyl)cyclobutane-1-carboxylic acid |
| InChIKey | LFTFNYUHJMESTD-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2(CC(C2)O)C(=O)O |
Computed by PubChem (NCBI)