Products 2031242-16-5

CAS 2031242-16-5 is the registry number for 3-Hydroxy-1-(4-methoxyphenyl)cyclobutane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-hydroxy-1-(4-methoxyphenyl)cyclobutane-1-carboxylic acid (CAS 2031242-16-5) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 3-hydroxy-1-(4-methoxyphenyl)cyclobutane-1-carboxylic acid. InChIKey: LFTFNYUHJMESTD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O4
Molecular weight222.24 g/mol
IUPAC name3-hydroxy-1-(4-methoxyphenyl)cyclobutane-1-carboxylic acid
InChIKeyLFTFNYUHJMESTD-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)C2(CC(C2)O)C(=O)O

Computed by PubChem (NCBI)