Products 157171-80-7
CAS 157171-80-7 is the registry number for D-Glucose-13C2,d2. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
(3R,4S,5S,6S)-6-[dideuterio(hydroxy)methyl]oxane-2,3,4,5-tetrol (CAS 157171-80-7) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 182.17 g/mol. IUPAC name: (3R,4S,5S,6S)-6-[dideuterio(hydroxy)methyl]oxane-2,3,4,5-tetrol. InChIKey: WQZGKKKJIJFFOK-DWBRGEJESA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | (3R,4S,5S,6S)-6-[dideuterio(hydroxy)methyl]oxane-2,3,4,5-tetrol |
| InChIKey | WQZGKKKJIJFFOK-DWBRGEJESA-N |
| SMILES | [2H]C([2H])([C@H]1[C@H]([C@@H]([C@H](C(O1)O)O)O)O)O |
Computed by PubChem (NCBI)