Products 157337-82-1

CAS 157337-82-1 is the registry number for 2,3,6-Trifluoro-4-(trifluoromethyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2,3,6-trifluoro-4-(trifluoromethyl)benzoic acid (CAS 157337-82-1) is a chemical compound with the molecular formula C8H2F6O2 and a molecular weight of 244.09 g/mol. IUPAC name: 2,3,6-trifluoro-4-(trifluoromethyl)benzoic acid. InChIKey: QWOCVHZTKMSWRC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H2F6O2
Molecular weight244.09 g/mol
IUPAC name2,3,6-trifluoro-4-(trifluoromethyl)benzoic acid
InChIKeyQWOCVHZTKMSWRC-UHFFFAOYSA-N
SMILESC1=C(C(=C(C(=C1F)C(=O)O)F)F)C(F)(F)F

Computed by PubChem (NCBI)