CAS 157337-82-1 is the registry number for 2,3,6-Trifluoro-4-(trifluoromethyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,3,6-trifluoro-4-(trifluoromethyl)benzoic acid (CAS 157337-82-1) is a chemical compound with the molecular formula C8H2F6O2 and a molecular weight of 244.09 g/mol. IUPAC name: 2,3,6-trifluoro-4-(trifluoromethyl)benzoic acid. InChIKey: QWOCVHZTKMSWRC-UHFFFAOYSA-N.
| Molecular formula | C8H2F6O2 |
|---|---|
| Molecular weight | 244.09 g/mol |
| IUPAC name | 2,3,6-trifluoro-4-(trifluoromethyl)benzoic acid |
| InChIKey | QWOCVHZTKMSWRC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)C(=O)O)F)F)C(F)(F)F |
Computed by PubChem (NCBI)