CAS 22252-67-1 is the registry number for 2-Fluoro-2-(perfluorophenyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-2-(2,3,4,5,6-pentafluorophenyl)acetic acid (CAS 22252-67-1) is a chemical compound with the molecular formula C8H2F6O2 and a molecular weight of 244.09 g/mol. IUPAC name: 2-fluoro-2-(2,3,4,5,6-pentafluorophenyl)acetic acid. InChIKey: VTUWCIWWRAIZCR-UHFFFAOYSA-N.
| Molecular formula | C8H2F6O2 |
|---|---|
| Molecular weight | 244.09 g/mol |
| IUPAC name | 2-fluoro-2-(2,3,4,5,6-pentafluorophenyl)acetic acid |
| InChIKey | VTUWCIWWRAIZCR-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)C(C(=O)O)F |
Computed by PubChem (NCBI)