Products 22252-67-1

CAS 22252-67-1 is the registry number for 2-Fluoro-2-(perfluorophenyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-fluoro-2-(2,3,4,5,6-pentafluorophenyl)acetic acid (CAS 22252-67-1) is a chemical compound with the molecular formula C8H2F6O2 and a molecular weight of 244.09 g/mol. IUPAC name: 2-fluoro-2-(2,3,4,5,6-pentafluorophenyl)acetic acid. InChIKey: VTUWCIWWRAIZCR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H2F6O2
Molecular weight244.09 g/mol
IUPAC name2-fluoro-2-(2,3,4,5,6-pentafluorophenyl)acetic acid
InChIKeyVTUWCIWWRAIZCR-UHFFFAOYSA-N
SMILESC1(=C(C(=C(C(=C1F)F)F)F)F)C(C(=O)O)F

Computed by PubChem (NCBI)