CAS 157337-84-3 appears in our catalog under these names: 2,3,4-Trifluoro-6-(trifluoromethyl)benzoic acid, 96%, 2,3,4-Trifluoro-6-(trifluoromethyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
2,3,4-trifluoro-6-(trifluoromethyl)benzoic acid (CAS 157337-84-3) is a chemical compound with the molecular formula C8H2F6O2 and a molecular weight of 244.09 g/mol. IUPAC name: 2,3,4-trifluoro-6-(trifluoromethyl)benzoic acid. InChIKey: OLTIALGKEMEUCV-UHFFFAOYSA-N.
| Molecular formula | C8H2F6O2 |
|---|---|
| Molecular weight | 244.09 g/mol |
| IUPAC name | 2,3,4-trifluoro-6-(trifluoromethyl)benzoic acid |
| InChIKey | OLTIALGKEMEUCV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)F)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)