CAS 157369-85-2 is the registry number for (R)-(-)-Ibuprofen (S)-(+)-Lysinate. Offered by: TRC. Available pack sizes: 250mg, 25mg.
(2S)-2,6-diaminohexanoic acid;(2R)-2-[4-(2-methylpropyl)phenyl]propanoic acid (CAS 157369-85-2) is a chemical compound with the molecular formula C19H32N2O4 and a molecular weight of 352.5 g/mol. IUPAC name: (2S)-2,6-diaminohexanoic acid;(2R)-2-[4-(2-methylpropyl)phenyl]propanoic acid. InChIKey: IHHXIUAEPKVVII-APFIOPMWSA-N.
| Molecular formula | C19H32N2O4 |
|---|---|
| Molecular weight | 352.5 g/mol |
| IUPAC name | (2S)-2,6-diaminohexanoic acid;(2R)-2-[4-(2-methylpropyl)phenyl]propanoic acid |
| InChIKey | IHHXIUAEPKVVII-APFIOPMWSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)CC(C)C)C(=O)O.C(CCN)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)