Products 312904-18-0
CAS 312904-18-0 appears in our catalog under these names: Oseltamivir Impurity 90, Oseltamivir Impurity 81. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (3R,4R,5S)-4-acetamido-3-pentan-3-yloxy-5-(prop-2-enylamino)cyclohexene-1-carboxylate (CAS 312904-18-0) is a chemical compound with the molecular formula C19H32N2O4 and a molecular weight of 352.5 g/mol. IUPAC name: ethyl (3R,4R,5S)-4-acetamido-3-pentan-3-yloxy-5-(prop-2-enylamino)cyclohexene-1-carboxylate. InChIKey: YAYJVAVBLBKVLR-RCCFBDPRSA-N.
| Molecular formula | C19H32N2O4 |
|---|---|
| Molecular weight | 352.5 g/mol |
| IUPAC name | ethyl (3R,4R,5S)-4-acetamido-3-pentan-3-yloxy-5-(prop-2-enylamino)cyclohexene-1-carboxylate |
| InChIKey | YAYJVAVBLBKVLR-RCCFBDPRSA-N |
| SMILES | CCC(CC)O[C@@H]1C=C(C[C@@H]([C@H]1NC(=O)C)NCC=C)C(=O)OCC |
Computed by PubChem (NCBI)