Products 57469-77-9
CAS 57469-77-9 appears in our catalog under these names: Ibuprofen Lysine, Ibuprofen Lysinate, >95% (HPLC), Ibuprofen L-lysine, 99%, Ibuprofen Lysine/ 99.66% (existing batch purity), Ibuprofen Lysine. Offered by: Chemat Brand, TRC, AmBeed, TargetMol, GLPBio. Available pack sizes: on request, 10g, 1g, 25mg, 5mg, 1mg, 10mg, 50mg.
(2S)-2,6-diaminohexanoic acid;2-[4-(2-methylpropyl)phenyl]propanoic acid (CAS 57469-77-9) is a chemical compound with the molecular formula C19H32N2O4 and a molecular weight of 352.5 g/mol. IUPAC name: (2S)-2,6-diaminohexanoic acid;2-[4-(2-methylpropyl)phenyl]propanoic acid. InChIKey: IHHXIUAEPKVVII-ZSCHJXSPSA-N.
| Molecular formula | C19H32N2O4 |
|---|---|
| Molecular weight | 352.5 g/mol |
| IUPAC name | (2S)-2,6-diaminohexanoic acid;2-[4-(2-methylpropyl)phenyl]propanoic acid |
| InChIKey | IHHXIUAEPKVVII-ZSCHJXSPSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C(C)C(=O)O.C(CCN)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
IBUPROFEN LYSINE, Ibuprofen lysinate, Neoprofen, Solufenum, Soluphene, Saren, ibuprofen l-lysine, Dolormin, Lisiprofen, Imbun