Products 157425-54-2
CAS 157425-54-2 is the registry number for methyl 5-acetyl-4-bromo-1H-pyrrole-2-carboxylate, 98%. Offered by: Chemat. Available pack sizes: 50mg.
Methyl 5-acetyl-4-bromo-1H-pyrrole-2-carboxylate (CAS 157425-54-2) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: methyl 5-acetyl-4-bromo-1H-pyrrole-2-carboxylate. InChIKey: IECZBSNUKCUXBB-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | methyl 5-acetyl-4-bromo-1H-pyrrole-2-carboxylate |
| InChIKey | IECZBSNUKCUXBB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(N1)C(=O)OC)Br |
Computed by PubChem (NCBI)