CAS 157593-00-5 is the registry number for 6-(1-(Hydroxyimino)ethyl)-1,3-dioxaindan-5-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(NE)-N-[1-(6-amino-1,3-benzodioxol-5-yl)ethylidene]hydroxylamine (CAS 157593-00-5) is a chemical compound with the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. IUPAC name: (NE)-N-[1-(6-amino-1,3-benzodioxol-5-yl)ethylidene]hydroxylamine. InChIKey: WSEMYTWGFFNSBF-VZUCSPMQSA-N.
| Molecular formula | C9H10N2O3 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | (NE)-N-[1-(6-amino-1,3-benzodioxol-5-yl)ethylidene]hydroxylamine |
| InChIKey | WSEMYTWGFFNSBF-VZUCSPMQSA-N |
| SMILES | C/C(=N\O)/C1=CC2=C(C=C1N)OCO2 |
Computed by PubChem (NCBI)