CAS 157610-19-0 appears in our catalog under these names: 6-Methyl-5H,10H-benzo(b)1,6-naphthyridin-10-one, 95%, 6-Methyl-5H,10H-benzo(b)1,6-naphthyridin-10-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-methyl-5H-benzo[b][1,6]naphthyridin-10-one (CAS 157610-19-0) is a chemical compound with the molecular formula C13H10N2O and a molecular weight of 210.23 g/mol. IUPAC name: 6-methyl-5H-benzo[b][1,6]naphthyridin-10-one. InChIKey: XESGCZVTAMZXMQ-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 6-methyl-5H-benzo[b][1,6]naphthyridin-10-one |
| InChIKey | XESGCZVTAMZXMQ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=O)C3=C(N2)C=CN=C3 |
Computed by PubChem (NCBI)