Products 157698-32-3
CAS 157698-32-3 appears in our catalog under these names: Tamoxifen-d5, >95% (HPLC), Tamoxifen-d5 (ethyl-d5), 98 atom % D, min 98% Chemical Purity, Tamoxifen-d5, Tamoxifen–d5, Tamoxifen-d5, 99.99%. Offered by: TRC, CDN, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 0,01g, 0,005g, 5mg, 25mg, 50mg, 500μg.
N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine (CAS 157698-32-3) is a chemical compound with the molecular formula C26H29NO and a molecular weight of 376.5 g/mol. IUPAC name: N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine. InChIKey: NKANXQFJJICGDU-FUYVPVGLSA-N.
| Molecular formula | C26H29NO |
|---|---|
| Molecular weight | 376.5 g/mol |
| IUPAC name | N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine |
| InChIKey | NKANXQFJJICGDU-FUYVPVGLSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])/C(=C(\C1=CC=CC=C1)/C2=CC=C(C=C2)OCCN(C)C)/C3=CC=CC=C3 |
Computed by PubChem (NCBI)