CAS 1577187-82-6 is the registry number for 4-(4-Propan-2-ylphenyl)-1-phenyl-1H-1,2,3-triazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
1-phenyl-4-(4-propan-2-ylphenyl)triazole (CAS 1577187-82-6) is a chemical compound with the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. IUPAC name: 1-phenyl-4-(4-propan-2-ylphenyl)triazole. InChIKey: SPYONNPUWXFSGY-UHFFFAOYSA-N.
| Molecular formula | C17H17N3 |
|---|---|
| Molecular weight | 263.34 g/mol |
| IUPAC name | 1-phenyl-4-(4-propan-2-ylphenyl)triazole |
| InChIKey | SPYONNPUWXFSGY-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C2=CN(N=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)