CAS 956751-68-1 appears in our catalog under these names: 1-(2,4-Dimethylphenyl)-3-phenyl-1H-pyrazol-5-amine, 95%, 1-(2,4-Dimethylphenyl)-3-phenyl-1H-pyrazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
1-(2,4-dimethylphenyl)-3-phenylpyrazol-5-amine (CAS 956751-68-1) is a chemical compound with the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. IUPAC name: 1-(2,4-dimethylphenyl)-3-phenylpyrazol-5-amine. InChIKey: WWHPUCFZLVPWMP-UHFFFAOYSA-N.
| Molecular formula | C17H17N3 |
|---|---|
| Molecular weight | 263.34 g/mol |
| IUPAC name | 1-(2,4-dimethylphenyl)-3-phenylpyrazol-5-amine |
| InChIKey | WWHPUCFZLVPWMP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2C(=CC(=N2)C3=CC=CC=C3)N)C |
Computed by PubChem (NCBI)