CAS 956726-82-2 is the registry number for (1-Benzyl-3-phenyl-1H-pyrazol-4-yl)methanamine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
(1-benzyl-3-phenylpyrazol-4-yl)methanamine (CAS 956726-82-2) is a chemical compound with the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. IUPAC name: (1-benzyl-3-phenylpyrazol-4-yl)methanamine. InChIKey: UPIXZRBUSDMNDT-UHFFFAOYSA-N.
| Molecular formula | C17H17N3 |
|---|---|
| Molecular weight | 263.34 g/mol |
| IUPAC name | (1-benzyl-3-phenylpyrazol-4-yl)methanamine |
| InChIKey | UPIXZRBUSDMNDT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C(=N2)C3=CC=CC=C3)CN |
Computed by PubChem (NCBI)