CAS 15777-41-0 is the registry number for 2-Chloro-N-(5-isopropyl-(1,3,4)thiadiazol-2-yl)-acetamide. Offered by: Biosynth. Available pack sizes: 10g, 1g.
2-chloro-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)acetamide (CAS 15777-41-0) is a chemical compound with the molecular formula C7H10ClN3OS and a molecular weight of 219.69 g/mol. IUPAC name: 2-chloro-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)acetamide. InChIKey: AARFUCMXVZRFBG-UHFFFAOYSA-N.
| Molecular formula | C7H10ClN3OS |
|---|---|
| Molecular weight | 219.69 g/mol |
| IUPAC name | 2-chloro-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)acetamide |
| InChIKey | AARFUCMXVZRFBG-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NN=C(S1)NC(=O)CCl |
Computed by PubChem (NCBI)