Products 2891724-62-0
CAS 2891724-62-0 is the registry number for N-(2-(2-Amino-5-chlorothiazol-4-yl)ethyl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[2-(2-amino-5-chloro-1,3-thiazol-4-yl)ethyl]acetamide (CAS 2891724-62-0) is a chemical compound with the molecular formula C7H10ClN3OS and a molecular weight of 219.69 g/mol. IUPAC name: N-[2-(2-amino-5-chloro-1,3-thiazol-4-yl)ethyl]acetamide. InChIKey: LUQJABMABMSDOB-UHFFFAOYSA-N.
| Molecular formula | C7H10ClN3OS |
|---|---|
| Molecular weight | 219.69 g/mol |
| IUPAC name | N-[2-(2-amino-5-chloro-1,3-thiazol-4-yl)ethyl]acetamide |
| InChIKey | LUQJABMABMSDOB-UHFFFAOYSA-N |
| SMILES | CC(=O)NCCC1=C(SC(=N1)N)Cl |
Computed by PubChem (NCBI)