CAS 391864-00-9 is the registry number for 2-Chloro-n-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-chloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide (CAS 391864-00-9) is a chemical compound with the molecular formula C7H10ClN3OS and a molecular weight of 219.69 g/mol. IUPAC name: 2-chloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide. InChIKey: OTRRQPRHLHNAKR-UHFFFAOYSA-N.
| Molecular formula | C7H10ClN3OS |
|---|---|
| Molecular weight | 219.69 g/mol |
| IUPAC name | 2-chloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide |
| InChIKey | OTRRQPRHLHNAKR-UHFFFAOYSA-N |
| SMILES | CCC1=NN=C(S1)NC(=O)C(C)Cl |
Computed by PubChem (NCBI)