CAS 15777-59-0 appears in our catalog under these names: 3-Bromo-5-phenyl-1h-1,2,4-triazole, 95%, 3-Bromo-5-phenyl-1H-1,2,4-triazole, 3-Bromo-5-phenyl-1H-1,2,4-triazole, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 0,5g.
5-bromo-3-phenyl-1H-1,2,4-triazole (CAS 15777-59-0) is a chemical compound with the molecular formula C8H6BrN3 and a molecular weight of 224.06 g/mol. IUPAC name: 5-bromo-3-phenyl-1H-1,2,4-triazole. InChIKey: SIQJGSXGBGMSOQ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3 |
|---|---|
| Molecular weight | 224.06 g/mol |
| IUPAC name | 5-bromo-3-phenyl-1H-1,2,4-triazole |
| InChIKey | SIQJGSXGBGMSOQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=N2)Br |
Computed by PubChem (NCBI)