Products 15785-53-2

CAS 15785-53-2 is the registry number for 3-Amino-4-hydroxy-5-methoxy-benzoic acid, hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

3-amino-4-hydroxy-5-methoxybenzoic acid;hydrochloride (CAS 15785-53-2) is a chemical compound with the molecular formula C8H10ClNO4 and a molecular weight of 219.62 g/mol. IUPAC name: 3-amino-4-hydroxy-5-methoxybenzoic acid;hydrochloride. InChIKey: FWZUXFNSQFBPKM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10ClNO4
Molecular weight219.62 g/mol
IUPAC name3-amino-4-hydroxy-5-methoxybenzoic acid;hydrochloride
InChIKeyFWZUXFNSQFBPKM-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1O)N)C(=O)O.Cl

Computed by PubChem (NCBI)