Products 2060020-59-7

CAS 2060020-59-7 is the registry number for 2,4-Dimethoxypyridine-3-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2,4-dimethoxypyridine-3-carboxylic acid;hydrochloride (CAS 2060020-59-7) is a chemical compound with the molecular formula C8H10ClNO4 and a molecular weight of 219.62 g/mol. IUPAC name: 2,4-dimethoxypyridine-3-carboxylic acid;hydrochloride. InChIKey: XSUWHHRJRHIIOA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10ClNO4
Molecular weight219.62 g/mol
IUPAC name2,4-dimethoxypyridine-3-carboxylic acid;hydrochloride
InChIKeyXSUWHHRJRHIIOA-UHFFFAOYSA-N
SMILESCOC1=C(C(=NC=C1)OC)C(=O)O.Cl

Computed by PubChem (NCBI)