CAS 2060020-59-7 is the registry number for 2,4-Dimethoxypyridine-3-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,4-dimethoxypyridine-3-carboxylic acid;hydrochloride (CAS 2060020-59-7) is a chemical compound with the molecular formula C8H10ClNO4 and a molecular weight of 219.62 g/mol. IUPAC name: 2,4-dimethoxypyridine-3-carboxylic acid;hydrochloride. InChIKey: XSUWHHRJRHIIOA-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO4 |
|---|---|
| Molecular weight | 219.62 g/mol |
| IUPAC name | 2,4-dimethoxypyridine-3-carboxylic acid;hydrochloride |
| InChIKey | XSUWHHRJRHIIOA-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=NC=C1)OC)C(=O)O.Cl |
Computed by PubChem (NCBI)