CAS 1822502-44-2 appears in our catalog under these names: 2–Amino–2–(3,5–dihydroxyphenyl)acetic acid hydrochloride, 2-Amino-2-(3,5-dihydroxyphenyl)acetic acid hydrochloride, 2-Amino-2-(3,5-dihydroxyphenyl)acetic acid hydrochloride, 97%, 2-Amino-2-(3,5-Dihydroxyphenyl)Acetic Acid Hydrochloride, 97%, 97%. Offered by: GLPBio, Biosynth, Fluorochem, Chemat. Available pack sizes: 100mg, 0,5g, 50mg, 250mg.
2-amino-2-(3,5-dihydroxyphenyl)acetic acid;hydrochloride (CAS 1822502-44-2) is a chemical compound with the molecular formula C8H10ClNO4 and a molecular weight of 219.62 g/mol. IUPAC name: 2-amino-2-(3,5-dihydroxyphenyl)acetic acid;hydrochloride. InChIKey: YZUABCCLGVXZIF-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO4 |
|---|---|
| Molecular weight | 219.62 g/mol |
| IUPAC name | 2-amino-2-(3,5-dihydroxyphenyl)acetic acid;hydrochloride |
| InChIKey | YZUABCCLGVXZIF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1O)O)C(C(=O)O)N.Cl |
Computed by PubChem (NCBI)