Products 158014-36-9

CAS 158014-36-9 is the registry number for 2,5-Dimethyl-N-phenylbenzamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

2,5-dimethyl-N-phenylbenzamide (CAS 158014-36-9) is a chemical compound with the molecular formula C15H15NO and a molecular weight of 225.28 g/mol. IUPAC name: 2,5-dimethyl-N-phenylbenzamide. InChIKey: WHXMCLIVMRPLFL-UHFFFAOYSA-N.

Identity
Molecular formulaC15H15NO
Molecular weight225.28 g/mol
IUPAC name2,5-dimethyl-N-phenylbenzamide
InChIKeyWHXMCLIVMRPLFL-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)C)C(=O)NC2=CC=CC=C2

Computed by PubChem (NCBI)