CAS 158014-36-9 is the registry number for 2,5-Dimethyl-N-phenylbenzamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
2,5-dimethyl-N-phenylbenzamide (CAS 158014-36-9) is a chemical compound with the molecular formula C15H15NO and a molecular weight of 225.28 g/mol. IUPAC name: 2,5-dimethyl-N-phenylbenzamide. InChIKey: WHXMCLIVMRPLFL-UHFFFAOYSA-N.
| Molecular formula | C15H15NO |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | 2,5-dimethyl-N-phenylbenzamide |
| InChIKey | WHXMCLIVMRPLFL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C(=O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)