CAS 158016-07-0 is the registry number for FA-Lys-Ala-OH. Offered by: Creative Peptides, Biosynth. Available pack sizes: on request, 250mg, 100mg, 500mg.
(2S)-2-[[(2S)-6-amino-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]hexanoyl]amino]propanoic acid (CAS 158016-07-0) is a chemical compound with the molecular formula C16H23N3O5 and a molecular weight of 337.37 g/mol. IUPAC name: (2S)-2-[[(2S)-6-amino-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]hexanoyl]amino]propanoic acid. InChIKey: BDYDXEHJPCUCAI-DDOQPMFUSA-N.
| Molecular formula | C16H23N3O5 |
|---|---|
| Molecular weight | 337.37 g/mol |
| IUPAC name | (2S)-2-[[(2S)-6-amino-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]hexanoyl]amino]propanoic acid |
| InChIKey | BDYDXEHJPCUCAI-DDOQPMFUSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@H](CCCCN)NC(=O)/C=C/C1=CC=CO1 |
Computed by PubChem (NCBI)