CAS 76079-03-3 appears in our catalog under these names: N-(3-(2-FURYL)ACRYLOYL-ALA-LYS, FA-Ala-Lys-OH, FA–Ala–Lys–OH, FA-Ala-Lys-OH, 98%, 98%. Offered by: Sigma-Aldrich, Creative Peptides, GLPBio, Chemat. Available pack sizes: 50MG, on request, 1g, 250mg.
(2S)-6-amino-2-[[(2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanoyl]amino]hexanoic acid (CAS 76079-03-3) is a chemical compound with the molecular formula C16H23N3O5 and a molecular weight of 337.37 g/mol. IUPAC name: (2S)-6-amino-2-[[(2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanoyl]amino]hexanoic acid. InChIKey: BZUABSYGNBFITP-DDOQPMFUSA-N.
| Molecular formula | C16H23N3O5 |
|---|---|
| Molecular weight | 337.37 g/mol |
| IUPAC name | (2S)-6-amino-2-[[(2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanoyl]amino]hexanoic acid |
| InChIKey | BZUABSYGNBFITP-DDOQPMFUSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CCCCN)C(=O)O)NC(=O)/C=C/C1=CC=CO1 |
Computed by PubChem (NCBI)