Products 1215205-93-8
CAS 1215205-93-8 is the registry number for 3-(4-BOC-piperazino)-4-nitroanisole, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
Tert-butyl 4-(5-methoxy-2-nitrophenyl)piperazine-1-carboxylate (CAS 1215205-93-8) is a chemical compound with the molecular formula C16H23N3O5 and a molecular weight of 337.37 g/mol. IUPAC name: tert-butyl 4-(5-methoxy-2-nitrophenyl)piperazine-1-carboxylate. InChIKey: OGPKHZOURJVUKL-UHFFFAOYSA-N.
| Molecular formula | C16H23N3O5 |
|---|---|
| Molecular weight | 337.37 g/mol |
| IUPAC name | tert-butyl 4-(5-methoxy-2-nitrophenyl)piperazine-1-carboxylate |
| InChIKey | OGPKHZOURJVUKL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=C(C=CC(=C2)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)