CAS 158038-69-8 is the registry number for 4-(Methyl-(toluene-4-sulfonyl)-amino)-benzoic acid methyl ester, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
Methyl 4-[methyl-(4-methylphenyl)sulfonylamino]benzoate (CAS 158038-69-8) is a chemical compound with the molecular formula C16H17NO4S and a molecular weight of 319.4 g/mol. IUPAC name: methyl 4-[methyl-(4-methylphenyl)sulfonylamino]benzoate. InChIKey: AZTPEGWYCCQLBW-UHFFFAOYSA-N.
| Molecular formula | C16H17NO4S |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | methyl 4-[methyl-(4-methylphenyl)sulfonylamino]benzoate |
| InChIKey | AZTPEGWYCCQLBW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(C)C2=CC=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)