Products 158069-71-7
CAS 158069-71-7 is the registry number for 2-Cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
(Z)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoic acid (CAS 158069-71-7) is a chemical compound with the molecular formula C10H6N2O6 and a molecular weight of 250.16 g/mol. IUPAC name: (Z)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoic acid. InChIKey: XDDDOLQEZBJWFZ-BHQIHCQQSA-N.
| Molecular formula | C10H6N2O6 |
|---|---|
| Molecular weight | 250.16 g/mol |
| IUPAC name | (Z)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoic acid |
| InChIKey | XDDDOLQEZBJWFZ-BHQIHCQQSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])O)O)/C=C(/C#N)\C(=O)O |
Computed by PubChem (NCBI)