Products 927801-05-6
CAS 927801-05-6 is the registry number for (4-Cyano-2-nitrophenyl)malonic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(4-cyano-2-nitrophenyl)propanedioic acid (CAS 927801-05-6) is a chemical compound with the molecular formula C10H6N2O6 and a molecular weight of 250.16 g/mol. IUPAC name: 2-(4-cyano-2-nitrophenyl)propanedioic acid. InChIKey: SAYWCWBFHQLUQZ-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O6 |
|---|---|
| Molecular weight | 250.16 g/mol |
| IUPAC name | 2-(4-cyano-2-nitrophenyl)propanedioic acid |
| InChIKey | SAYWCWBFHQLUQZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)[N+](=O)[O-])C(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)