Products 209324-72-1
CAS 209324-72-1 is the registry number for 4-Acetamido-5-nitrophthalic anhydride, 98.00%. Offered by: Chemat. Available pack sizes: 1g, 250mg.
N-(6-nitro-1,3-dioxo-2-benzofuran-5-yl)acetamide (CAS 209324-72-1) is a chemical compound with the molecular formula C10H6N2O6 and a molecular weight of 250.16 g/mol. IUPAC name: N-(6-nitro-1,3-dioxo-2-benzofuran-5-yl)acetamide. InChIKey: VEJJHTUTLMCTLY-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O6 |
|---|---|
| Molecular weight | 250.16 g/mol |
| IUPAC name | N-(6-nitro-1,3-dioxo-2-benzofuran-5-yl)acetamide |
| InChIKey | VEJJHTUTLMCTLY-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C2C(=C1)C(=O)OC2=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)