CAS 1581694-94-1 appears in our catalog under these names: Methiocarb–d3, Methiocarb-d3, >95% (HPLC), Methiocarb D3 (N-methyl D3), Methiocarb D3 (N-methyl D3) 100 µg/mL in Cyclohexane, Methiocarb-d3 (N-methyl-d3), 99 atom % D, min 96% Chemical Purity. Offered by: GLPBio, TRC, Dr. Ehrenstorfer, CDN, Biosynth. Available pack sizes: 1mg, 10mg, 1ml, 0,01g, 0,005g, 5mg, 25mg, 50mg.
(3,5-dimethyl-4-methylsulfanylphenyl) N-(trideuteriomethyl)carbamate (CAS 1581694-94-1) is a chemical compound with the molecular formula C11H15NO2S and a molecular weight of 228.33 g/mol. IUPAC name: (3,5-dimethyl-4-methylsulfanylphenyl) N-(trideuteriomethyl)carbamate. InChIKey: YFBPRJGDJKVWAH-HPRDVNIFSA-N.
| Molecular formula | C11H15NO2S |
|---|---|
| Molecular weight | 228.33 g/mol |
| IUPAC name | (3,5-dimethyl-4-methylsulfanylphenyl) N-(trideuteriomethyl)carbamate |
| InChIKey | YFBPRJGDJKVWAH-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])NC(=O)OC1=CC(=C(C(=C1)C)SC)C |
Computed by PubChem (NCBI)