CAS 158326-84-2 appears in our catalog under these names: 6-bromo-3,3-dimethylindolin-2-one, 6-Bromo-3,3-dimethylindolin-2-one, 95%, 6-Bromo-3,3-dimethylindolin-2-one 95%, 6-BROMO-3,3-DIMETHYLINDOLIN-2-ONE, 98%, 6-Bromo-3,3-dimethyl-2,3-dihydro-1h-indol-2-one, >95% (HPLC). Offered by: Biosynth, Combi-blocks, Ambeed, Fluorochem, TRC. Available pack sizes: 2,5g, 250mg, 25g, 1g, 10g, 5g, 100mg, 500mg.
6-bromo-3,3-dimethyl-1H-indol-2-one (CAS 158326-84-2) is a chemical compound with the molecular formula C10H10BrNO and a molecular weight of 240.10 g/mol. IUPAC name: 6-bromo-3,3-dimethyl-1H-indol-2-one. InChIKey: DBAOYNGOQUASPE-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 6-bromo-3,3-dimethyl-1H-indol-2-one |
| InChIKey | DBAOYNGOQUASPE-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)Br)NC1=O)C |
Computed by PubChem (NCBI)