CAS 1584155-05-4 is the registry number for (S)-2-(2-(oxiran-2-yl)ethyl)isoindoline-1,3-dione, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
2-[2-[(2S)-oxiran-2-yl]ethyl]isoindole-1,3-dione (CAS 1584155-05-4) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: 2-[2-[(2S)-oxiran-2-yl]ethyl]isoindole-1,3-dione. InChIKey: KPQFNAHIBWPUSX-QMMMGPOBSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 2-[2-[(2S)-oxiran-2-yl]ethyl]isoindole-1,3-dione |
| InChIKey | KPQFNAHIBWPUSX-QMMMGPOBSA-N |
| SMILES | C1[C@@H](O1)CCN2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)