CAS 86506-70-9 appears in our catalog under these names: 2–(2–(Oxiran–2–yl)ethyl)isoindoline–1,3–dione, 2-(2-(Oxiran-2-yl)ethyl)-2,3-dihydro-1H-isoindole-1,3-dione, 2-(2-(Oxiran-2-yl)ethyl)isoindoline-1,3-dione, 97%, 97%, 2-(2-OXIRANYL-ETHYL)-ISOINDOLE-1,3-DIONE, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 2,5g, 5g.
2-[2-(oxiran-2-yl)ethyl]isoindole-1,3-dione (CAS 86506-70-9) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: 2-[2-(oxiran-2-yl)ethyl]isoindole-1,3-dione. InChIKey: KPQFNAHIBWPUSX-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 2-[2-(oxiran-2-yl)ethyl]isoindole-1,3-dione |
| InChIKey | KPQFNAHIBWPUSX-UHFFFAOYSA-N |
| SMILES | C1C(O1)CCN2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)