CAS 1585251-39-3 is the registry number for (S)-2-Amino-N-(3,5-dimethoxyphenyl)-3-methylbutanamide hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-N-(3,5-dimethoxyphenyl)-3-methylbutanamide;hydrochloride (CAS 1585251-39-3) is a chemical compound with the molecular formula C13H21ClN2O3 and a molecular weight of 288.77 g/mol. IUPAC name: (2S)-2-amino-N-(3,5-dimethoxyphenyl)-3-methylbutanamide;hydrochloride. InChIKey: WBVYPMRGRUFYOP-YDALLXLXSA-N.
| Molecular formula | C13H21ClN2O3 |
|---|---|
| Molecular weight | 288.77 g/mol |
| IUPAC name | (2S)-2-amino-N-(3,5-dimethoxyphenyl)-3-methylbutanamide;hydrochloride |
| InChIKey | WBVYPMRGRUFYOP-YDALLXLXSA-N |
| SMILES | CC(C)[C@@H](C(=O)NC1=CC(=CC(=C1)OC)OC)N.Cl |
Computed by PubChem (NCBI)