Products 2378502-80-6

CAS 2378502-80-6 is the registry number for tert-Butyl N-(2-(2-aminoethoxy)phenyl)carbamate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[2-(2-aminoethoxy)phenyl]carbamate;hydrochloride (CAS 2378502-80-6) is a chemical compound with the molecular formula C13H21ClN2O3 and a molecular weight of 288.77 g/mol. IUPAC name: tert-butyl N-[2-(2-aminoethoxy)phenyl]carbamate;hydrochloride. InChIKey: KALSUVLGHJISHB-UHFFFAOYSA-N.

Identity
Molecular formulaC13H21ClN2O3
Molecular weight288.77 g/mol
IUPAC nametert-butyl N-[2-(2-aminoethoxy)phenyl]carbamate;hydrochloride
InChIKeyKALSUVLGHJISHB-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=CC=CC=C1OCCN.Cl

Computed by PubChem (NCBI)